C32H39N7O2 — CID 171095362
acetylene;N-[4-[[1-[(Z)-ethylideneamino]-2H-pyridin-4-yl]oxy]-3-methylphenyl]-9-oxa-2,13,15,18-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),11,13,15,17-pentaen-16-amine;propane (PubChem CID 171095362) has the molecular formula C32H39N7O2 and a molecular weight of 553.71 g/mol. Its IUPAC name is acetylene;N-[4-[[1-[(Z)-ethylideneamino]-2H-pyridin-4-yl]oxy]-3-methylphenyl]-9-oxa-2,13,15,18-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),11,13,15,17-pentaen-16-amine;propane.
| Compound Name | acetylene;N-[4-[[1-[(Z)-ethylideneamino]-2H-pyridin-4-yl]oxy]-3-methylphenyl]-9-oxa-2,13,15,18-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),11,13,15,17-pentaen-16-amine;propane |
|---|---|
| PubChem CID | 171095362 |
| Molecular Formula | C32H39N7O2 |
| Molecular Weight | 553.71 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | acetylene;N-[4-[[1-[(Z)-ethylideneamino]-2H-pyridin-4-yl]oxy]-3-methylphenyl]-9-oxa-2,13,15,18-tetrazatetracyclo[8.8.0.02,7.012,17]octadeca-1(10),11,13,15,17-pentaen-16-amine;propane |
| SMILES | C#C.C/C=N\N1C=CC(Oc2ccc(Nc3ncnc4cc5c(nc34)N3CCCCC3CO5)cc2C)=CC1.CCC |
| InChI | InChI=1S/C27H29N7O2.C3H8.C2H2/c1-3-30-33-12-9-21(10-13-33)36-23-8-7-19(14-18(23)2)31-26-25-22(28-17-29-26)15-24-27(32-25)34-11-5-4-6-20(34)16-35-24;1-3-2;1-2/h3,7-10,12,14-15,17,20H,4-6,11,13,16H2,1-2H3,(H,28,29,31);3H2,1-2H3;1-2H/b30-3-;; |
| InChIKey | PHZJRZWATJVOKK-GQMRESBMSA-N |
| XLogP | 6.59 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.71 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|