C17H24F3NOS — CID 171095884
1-[4-cyclopropyl-3-[3-(trifluoromethyl)phenyl]-1,2-thiazolidin-5-yl]ethanone;ethane;molecular hydrogen (PubChem CID 171095884) has the molecular formula C17H24F3NOS and a molecular weight of 347.45 g/mol. Its IUPAC name is 1-[4-cyclopropyl-3-[3-(trifluoromethyl)phenyl]-1,2-thiazolidin-5-yl]ethanone;ethane;molecular hydrogen.
| Compound Name | 1-[4-cyclopropyl-3-[3-(trifluoromethyl)phenyl]-1,2-thiazolidin-5-yl]ethanone;ethane;molecular hydrogen |
|---|---|
| PubChem CID | 171095884 |
| Molecular Formula | C17H24F3NOS |
| Molecular Weight | 347.45 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 1-[4-cyclopropyl-3-[3-(trifluoromethyl)phenyl]-1,2-thiazolidin-5-yl]ethanone;ethane;molecular hydrogen |
| SMILES | CC.CC(=O)C1SNC(c2cccc(C(F)(F)F)c2)C1C1CC1.[H][H] |
| InChI | InChI=1S/C15H16F3NOS.C2H6.H2/c1-8(20)14-12(9-5-6-9)13(19-21-14)10-3-2-4-11(7-10)15(16,17)18;1-2;/h2-4,7,9,12-14,19H,5-6H2,1H3;1-2H3;1H |
| InChIKey | ZCXVHPOHXLBZFA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.45 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|