C7H14FN — CID 171096527
(E)-2-(fluoromethyl)-N,N-dimethylbut-2-en-1-amine (PubChem CID 171096527) has the molecular formula C7H14FN and a molecular weight of 131.19 g/mol. Its IUPAC name is (E)-2-(fluoromethyl)-N,N-dimethylbut-2-en-1-amine.
| Compound Name | (E)-2-(fluoromethyl)-N,N-dimethylbut-2-en-1-amine |
|---|---|
| PubChem CID | 171096527 |
| Molecular Formula | C7H14FN |
| Molecular Weight | 131.19 g/mol |
| Exact Mass | 131.11 |
| IUPAC Name | (E)-2-(fluoromethyl)-N,N-dimethylbut-2-en-1-amine |
| SMILES | C/C=C(/CF)CN(C)C |
| InChI | InChI=1S/C7H14FN/c1-4-7(5-8)6-9(2)3/h4H,5-6H2,1-3H3/b7-4- |
| InChIKey | NABQIHCTMRGIBJ-DAXSKMNVSA-N |
| XLogP | 1.46 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.19 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|