C7H5F3N2O3 — CID 171098992
2,2-dihydroxy-1-[5-(trifluoromethyl)pyrazin-2-yl]ethanone (PubChem CID 171098992) has the molecular formula C7H5F3N2O3 and a molecular weight of 222.12 g/mol. Its IUPAC name is 2,2-dihydroxy-1-[5-(trifluoromethyl)pyrazin-2-yl]ethanone.
| Compound Name | 2,2-dihydroxy-1-[5-(trifluoromethyl)pyrazin-2-yl]ethanone |
|---|---|
| PubChem CID | 171098992 |
| Molecular Formula | C7H5F3N2O3 |
| Molecular Weight | 222.12 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 2,2-dihydroxy-1-[5-(trifluoromethyl)pyrazin-2-yl]ethanone |
| SMILES | O=C(c1cnc(C(F)(F)F)cn1)C(O)O |
| InChI | InChI=1S/C7H5F3N2O3/c8-7(9,10)4-2-11-3(1-12-4)5(13)6(14)15/h1-2,6,14-15H |
| InChIKey | KNQFSDYZYCVGTJ-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.12 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|