C9H14N2O — CID 171099293
(2Z)-N-ethyl-3-methyl-2-(methylideneamino)penta-2,4-dienamide (PubChem CID 171099293) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is (2Z)-N-ethyl-3-methyl-2-(methylideneamino)penta-2,4-dienamide.
| Compound Name | (2Z)-N-ethyl-3-methyl-2-(methylideneamino)penta-2,4-dienamide |
|---|---|
| PubChem CID | 171099293 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | (2Z)-N-ethyl-3-methyl-2-(methylideneamino)penta-2,4-dienamide |
| SMILES | C=C/C(C)=C(\N=C)C(=O)NCC |
| InChI | InChI=1S/C9H14N2O/c1-5-7(3)8(10-4)9(12)11-6-2/h5H,1,4,6H2,2-3H3,(H,11,12)/b8-7- |
| InChIKey | VGLUSXBPKSLICJ-FPLPWBNLSA-N |
| XLogP | 1.28 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|