C18H23BrN4 — CID 171101393
2-[4-(4-bromoimidazol-1-yl)phenyl]-8-methyl-2,8-diazaspiro[4.5]decane (PubChem CID 171101393) has the molecular formula C18H23BrN4 and a molecular weight of 375.31 g/mol. Its IUPAC name is 2-[4-(4-bromoimidazol-1-yl)phenyl]-8-methyl-2,8-diazaspiro[4.5]decane.
| Compound Name | 2-[4-(4-bromoimidazol-1-yl)phenyl]-8-methyl-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 171101393 |
| Molecular Formula | C18H23BrN4 |
| Molecular Weight | 375.31 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 2-[4-(4-bromoimidazol-1-yl)phenyl]-8-methyl-2,8-diazaspiro[4.5]decane |
| SMILES | CN1CCC2(CC1)CCN(c1ccc(-n3cnc(Br)c3)cc1)C2 |
| InChI | InChI=1S/C18H23BrN4/c1-21-9-6-18(7-10-21)8-11-22(13-18)15-2-4-16(5-3-15)23-12-17(19)20-14-23/h2-5,12,14H,6-11,13H2,1H3 |
| InChIKey | KKLSDHXIDFTGON-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|