C26H29N7O3 — CID 171103760
1-[2-[2-hydroxyethyl(methyl)amino]-4-methoxy-5-[[4-(1-methylpyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-yl]amino]anilino]but-3-en-2-one (PubChem CID 171103760) has the molecular formula C26H29N7O3 and a molecular weight of 487.56 g/mol. Its IUPAC name is 1-[2-[2-hydroxyethyl(methyl)amino]-4-methoxy-5-[[4-(1-methylpyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-yl]amino]anilino]but-3-en-2-one.
| Compound Name | 1-[2-[2-hydroxyethyl(methyl)amino]-4-methoxy-5-[[4-(1-methylpyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-yl]amino]anilino]but-3-en-2-one |
|---|---|
| PubChem CID | 171103760 |
| Molecular Formula | C26H29N7O3 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | 1-[2-[2-hydroxyethyl(methyl)amino]-4-methoxy-5-[[4-(1-methylpyrrolo[2,3-b]pyridin-3-yl)pyrimidin-2-yl]amino]anilino]but-3-en-2-one |
| SMILES | C=CC(=O)CNc1cc(Nc2nccc(-c3cn(C)c4ncccc34)n2)c(OC)cc1N(C)CCO |
| InChI | InChI=1S/C26H29N7O3/c1-5-17(35)15-29-21-13-22(24(36-4)14-23(21)32(2)11-12-34)31-26-28-10-8-20(30-26)19-16-33(3)25-18(19)7-6-9-27-25/h5-10,13-14,16,29,34H,1,11-12,15H2,2-4H3,(H,28,30,31) |
| InChIKey | KRTSVXUYQWDXML-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 117.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|