C26H27FN6O2 — CID 171103788
(E)-4-(dimethylamino)-N-[2-fluoro-5-[[4-(1H-indol-3-yl)-5-methylpyrimidin-2-yl]amino]-4-methoxyphenyl]but-2-enamide (PubChem CID 171103788) has the molecular formula C26H27FN6O2 and a molecular weight of 474.54 g/mol. Its IUPAC name is (E)-4-(dimethylamino)-N-[2-fluoro-5-[[4-(1H-indol-3-yl)-5-methylpyrimidin-2-yl]amino]-4-methoxyphenyl]but-2-enamide.
| Compound Name | (E)-4-(dimethylamino)-N-[2-fluoro-5-[[4-(1H-indol-3-yl)-5-methylpyrimidin-2-yl]amino]-4-methoxyphenyl]but-2-enamide |
|---|---|
| PubChem CID | 171103788 |
| Molecular Formula | C26H27FN6O2 |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.22 |
| IUPAC Name | (E)-4-(dimethylamino)-N-[2-fluoro-5-[[4-(1H-indol-3-yl)-5-methylpyrimidin-2-yl]amino]-4-methoxyphenyl]but-2-enamide |
| SMILES | COc1cc(F)c(NC(=O)/C=C/CN(C)C)cc1Nc1ncc(C)c(-c2c[nH]c3ccccc23)n1 |
| InChI | InChI=1S/C26H27FN6O2/c1-16-14-29-26(32-25(16)18-15-28-20-9-6-5-8-17(18)20)31-22-13-21(19(27)12-23(22)35-4)30-24(34)10-7-11-33(2)3/h5-10,12-15,28H,11H2,1-4H3,(H,30,34)(H,29,31,32)/b10-7+ |
| InChIKey | YASFFZCZXLLUIE-JXMROGBWSA-N |
| XLogP | 4.88 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|