C35H47ClN4O3 — CID 171104522
tert-butyl N-[4-[[4-[1-(3-chloro-2-formylphenyl)-3,3-dimethyl-2-methyliminoindol-5-yl]piperidin-1-yl]methyl]cyclohexyl]carbamate (PubChem CID 171104522) has the molecular formula C35H47ClN4O3 and a molecular weight of 607.24 g/mol. Its IUPAC name is tert-butyl N-[4-[[4-[1-(3-chloro-2-formylphenyl)-3,3-dimethyl-2-methyliminoindol-5-yl]piperidin-1-yl]methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[4-[[4-[1-(3-chloro-2-formylphenyl)-3,3-dimethyl-2-methyliminoindol-5-yl]piperidin-1-yl]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 171104522 |
| Molecular Formula | C35H47ClN4O3 |
| Molecular Weight | 607.24 g/mol |
| Exact Mass | 606.33 |
| IUPAC Name | tert-butyl N-[4-[[4-[1-(3-chloro-2-formylphenyl)-3,3-dimethyl-2-methyliminoindol-5-yl]piperidin-1-yl]methyl]cyclohexyl]carbamate |
| SMILES | C/N=C1/N(c2cccc(Cl)c2C=O)c2ccc(C3CCN(CC4CCC(NC(=O)OC(C)(C)C)CC4)CC3)cc2C1(C)C |
| InChI | InChI=1S/C35H47ClN4O3/c1-34(2,3)43-33(42)38-26-13-10-23(11-14-26)21-39-18-16-24(17-19-39)25-12-15-31-28(20-25)35(4,5)32(37-6)40(31)30-9-7-8-29(36)27(30)22-41/h7-9,12,15,20,22-24,26H,10-11,13-14,16-19,21H2,1-6H3,(H,38,42)/b37-32+ |
| InChIKey | VRQTULRICVVNLF-BQNXFWFHSA-N |
| XLogP | 7.87 |
| TPSA | 74.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.24 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|