C28H34ClN3O4 — CID 177027943
tert-butyl 4-[1-(3-chloro-2-formylphenyl)-3,3-dimethyl-2-methyliminoindol-6-yl]-4-hydroxypiperidine-1-carboxylate (PubChem CID 177027943) has the molecular formula C28H34ClN3O4 and a molecular weight of 512.05 g/mol. Its IUPAC name is tert-butyl 4-[1-(3-chloro-2-formylphenyl)-3,3-dimethyl-2-methyliminoindol-6-yl]-4-hydroxypiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(3-chloro-2-formylphenyl)-3,3-dimethyl-2-methyliminoindol-6-yl]-4-hydroxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 177027943 |
| Molecular Formula | C28H34ClN3O4 |
| Molecular Weight | 512.05 g/mol |
| Exact Mass | 511.22 |
| IUPAC Name | tert-butyl 4-[1-(3-chloro-2-formylphenyl)-3,3-dimethyl-2-methyliminoindol-6-yl]-4-hydroxypiperidine-1-carboxylate |
| SMILES | C/N=C1/N(c2cccc(Cl)c2C=O)c2cc(C3(O)CCN(C(=O)OC(C)(C)C)CC3)ccc2C1(C)C |
| InChI | InChI=1S/C28H34ClN3O4/c1-26(2,3)36-25(34)31-14-12-28(35,13-15-31)18-10-11-20-23(16-18)32(24(30-6)27(20,4)5)22-9-7-8-21(29)19(22)17-33/h7-11,16-17,35H,12-15H2,1-6H3/b30-24+ |
| InChIKey | DYNKAWXYXDJQNC-BGABXYSRSA-N |
| XLogP | 5.83 |
| TPSA | 82.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.05 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|