C27H35ClN4O4 — CID 171104394
tert-butyl 4-[1-(3-chloro-2-formylphenyl)-3,3-dimethyl-2-oxoindol-6-yl]piperazine-1-carboxylate;methanamine (PubChem CID 171104394) has the molecular formula C27H35ClN4O4 and a molecular weight of 515.05 g/mol. Its IUPAC name is tert-butyl 4-[1-(3-chloro-2-formylphenyl)-3,3-dimethyl-2-oxoindol-6-yl]piperazine-1-carboxylate;methanamine.
| Compound Name | tert-butyl 4-[1-(3-chloro-2-formylphenyl)-3,3-dimethyl-2-oxoindol-6-yl]piperazine-1-carboxylate;methanamine |
|---|---|
| PubChem CID | 171104394 |
| Molecular Formula | C27H35ClN4O4 |
| Molecular Weight | 515.05 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | tert-butyl 4-[1-(3-chloro-2-formylphenyl)-3,3-dimethyl-2-oxoindol-6-yl]piperazine-1-carboxylate;methanamine |
| SMILES | CC(C)(C)OC(=O)N1CCN(c2ccc3c(c2)N(c2cccc(Cl)c2C=O)C(=O)C3(C)C)CC1.CN |
| InChI | InChI=1S/C26H30ClN3O4.CH5N/c1-25(2,3)34-24(33)29-13-11-28(12-14-29)17-9-10-19-22(15-17)30(23(32)26(19,4)5)21-8-6-7-20(27)18(21)16-31;1-2/h6-10,15-16H,11-14H2,1-5H3;2H2,1H3 |
| InChIKey | RMRYPHZCAGWISB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.05 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|