C19H26O2 — CID 171107415
(1E)-14-(methoxymethyl)-3,6-dimethyl-10-methylidenetricyclo[9.3.0.03,7]tetradeca-1,6-dien-9-one (PubChem CID 171107415) has the molecular formula C19H26O2 and a molecular weight of 286.41 g/mol. Its IUPAC name is (1E)-14-(methoxymethyl)-3,6-dimethyl-10-methylidenetricyclo[9.3.0.03,7]tetradeca-1,6-dien-9-one.
| Compound Name | (1E)-14-(methoxymethyl)-3,6-dimethyl-10-methylidenetricyclo[9.3.0.03,7]tetradeca-1,6-dien-9-one |
|---|---|
| PubChem CID | 171107415 |
| Molecular Formula | C19H26O2 |
| Molecular Weight | 286.41 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | (1E)-14-(methoxymethyl)-3,6-dimethyl-10-methylidenetricyclo[9.3.0.03,7]tetradeca-1,6-dien-9-one |
| SMILES | C=C1C(=O)CC2=C(C)CCC2(C)/C=C2/C(COC)CCC12 |
| InChI | InChI=1S/C19H26O2/c1-12-7-8-19(3)10-16-14(11-21-4)5-6-15(16)13(2)18(20)9-17(12)19/h10,14-15H,2,5-9,11H2,1,3-4H3/b16-10- |
| InChIKey | VEQCATZYHDNRMZ-YBEGLDIGSA-N |
| XLogP | 4.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.41 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|