C22H34O3 — CID 123847886
2-[2-[4-(methoxymethyl)-3-(2-oxohex-3-enylidene)cyclohexyl]ethyl]-2-methylcyclopentan-1-one (PubChem CID 123847886) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is 2-[2-[4-(methoxymethyl)-3-(2-oxohex-3-enylidene)cyclohexyl]ethyl]-2-methylcyclopentan-1-one.
| Compound Name | 2-[2-[4-(methoxymethyl)-3-(2-oxohex-3-enylidene)cyclohexyl]ethyl]-2-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 123847886 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 2-[2-[4-(methoxymethyl)-3-(2-oxohex-3-enylidene)cyclohexyl]ethyl]-2-methylcyclopentan-1-one |
| SMILES | CCC=CC(=O)C=C1CC(CCC2(C)CCCC2=O)CCC1COC |
| InChI | InChI=1S/C22H34O3/c1-4-5-7-20(23)15-19-14-17(9-10-18(19)16-25-3)11-13-22(2)12-6-8-21(22)24/h5,7,15,17-18H,4,6,8-14,16H2,1-3H3 |
| InChIKey | CTAGOTSYJJUJPH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|