C15H23NO5 — CID 171108476
2-O-tert-butyl 1-O-methyl (1R,3aS,4R,7S,7aR)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-1,2-dicarboxylate (PubChem CID 171108476) has the molecular formula C15H23NO5 and a molecular weight of 297.35 g/mol. Its IUPAC name is 2-O-tert-butyl 1-O-methyl (1R,3aS,4R,7S,7aR)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-1,2-dicarboxylate.
| Compound Name | 2-O-tert-butyl 1-O-methyl (1R,3aS,4R,7S,7aR)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 171108476 |
| Molecular Formula | C15H23NO5 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-O-tert-butyl 1-O-methyl (1R,3aS,4R,7S,7aR)-1,3,3a,4,5,6,7,7a-octahydro-4,7-epoxyisoindole-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@H]2[C@@H](CN1C(=O)OC(C)(C)C)[C@H]1CC[C@@H]2O1 |
| InChI | InChI=1S/C15H23NO5/c1-15(2,3)21-14(18)16-7-8-9-5-6-10(20-9)11(8)12(16)13(17)19-4/h8-12H,5-7H2,1-4H3/t8-,9+,10-,11-,12+/m0/s1 |
| InChIKey | UTCASAFRVNZWTG-KZZRWZIVSA-N |
| XLogP | 1.57 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |