C18H17N3O — CID 171108749
2-ethyl-4-(4-methoxyphenyl)-6-phenyl-1,3,5-triazine (PubChem CID 171108749) has the molecular formula C18H17N3O and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-ethyl-4-(4-methoxyphenyl)-6-phenyl-1,3,5-triazine.
| Compound Name | 2-ethyl-4-(4-methoxyphenyl)-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 171108749 |
| Molecular Formula | C18H17N3O |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-ethyl-4-(4-methoxyphenyl)-6-phenyl-1,3,5-triazine |
| SMILES | CCc1nc(-c2ccccc2)nc(-c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C18H17N3O/c1-3-16-19-17(13-7-5-4-6-8-13)21-18(20-16)14-9-11-15(22-2)12-10-14/h4-12H,3H2,1-2H3 |
| InChIKey | PMEIQFINQSQOPS-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 47.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |