C21H24N4O — CID 134997342
N-butyl-4-[(4-methoxyphenyl)methyl]-6-phenyl-1,3,5-triazin-2-amine (PubChem CID 134997342) has the molecular formula C21H24N4O and a molecular weight of 348.45 g/mol. Its IUPAC name is N-butyl-4-[(4-methoxyphenyl)methyl]-6-phenyl-1,3,5-triazin-2-amine.
| Compound Name | N-butyl-4-[(4-methoxyphenyl)methyl]-6-phenyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 134997342 |
| Molecular Formula | C21H24N4O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | N-butyl-4-[(4-methoxyphenyl)methyl]-6-phenyl-1,3,5-triazin-2-amine |
| SMILES | CCCCNc1nc(Cc2ccc(OC)cc2)nc(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H24N4O/c1-3-4-14-22-21-24-19(15-16-10-12-18(26-2)13-11-16)23-20(25-21)17-8-6-5-7-9-17/h5-13H,3-4,14-15H2,1-2H3,(H,22,23,24,25) |
| InChIKey | JSFCSRUIZPTGKE-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|