C23H30N5P — CID 44515508
2-N,4-N-dibutyl-6-diphenylphosphanyl-1,3,5-triazine-2,4-diamine (PubChem CID 44515508) has the molecular formula C23H30N5P and a molecular weight of 407.50 g/mol. Its IUPAC name is 2-N,4-N-dibutyl-6-diphenylphosphanyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,4-N-dibutyl-6-diphenylphosphanyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 44515508 |
| Molecular Formula | C23H30N5P |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.22 |
| IUPAC Name | 2-N,4-N-dibutyl-6-diphenylphosphanyl-1,3,5-triazine-2,4-diamine |
| SMILES | CCCCNc1nc(NCCCC)nc(P(c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C23H30N5P/c1-3-5-17-24-21-26-22(25-18-6-4-2)28-23(27-21)29(19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-16H,3-6,17-18H2,1-2H3,(H2,24,25,26,27,28) |
| InChIKey | XXAIZEKWYCLUCR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 62.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|