C19H26N6 — CID 177429395
4-N,6-N-dibutyl-2-N-(2-ethynylphenyl)-1,3,5-triazine-2,4,6-triamine (PubChem CID 177429395) has the molecular formula C19H26N6 and a molecular weight of 338.46 g/mol. Its IUPAC name is 4-N,6-N-dibutyl-2-N-(2-ethynylphenyl)-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N,6-N-dibutyl-2-N-(2-ethynylphenyl)-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 177429395 |
| Molecular Formula | C19H26N6 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 4-N,6-N-dibutyl-2-N-(2-ethynylphenyl)-1,3,5-triazine-2,4,6-triamine |
| SMILES | C#Cc1ccccc1Nc1nc(NCCCC)nc(NCCCC)n1 |
| InChI | InChI=1S/C19H26N6/c1-4-7-13-20-17-23-18(21-14-8-5-2)25-19(24-17)22-16-12-10-9-11-15(16)6-3/h3,9-12H,4-5,7-8,13-14H2,1-2H3,(H3,20,21,22,23,24,25) |
| InChIKey | XJHXXAPZRIZRRM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 74.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|