C18H22BFN2O3S — CID 171109817
1-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-6-thiophen-2-yl-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine (PubChem CID 171109817) has the molecular formula C18H22BFN2O3S and a molecular weight of 376.26 g/mol. Its IUPAC name is 1-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-6-thiophen-2-yl-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine.
| Compound Name | 1-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-6-thiophen-2-yl-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 171109817 |
| Molecular Formula | C18H22BFN2O3S |
| Molecular Weight | 376.26 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 1-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]-6-thiophen-2-yl-6,8-dihydro-5H-imidazo[5,1-c][1,4]oxazine |
| SMILES | CC1(C)OB(C(F)=Cc2ncn3c2COC(c2cccs2)C3)OC1(C)C |
| InChI | InChI=1S/C18H22BFN2O3S/c1-17(2)18(3,4)25-19(24-17)16(20)8-12-13-10-23-14(9-22(13)11-21-12)15-6-5-7-26-15/h5-8,11,14H,9-10H2,1-4H3 |
| InChIKey | ZQDGVULWSFFJNP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.26 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|