C11H11ClN2OS — CID 121204837
2-(chloromethyl)-6-thiophen-2-yl-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine (PubChem CID 121204837) has the molecular formula C11H11ClN2OS and a molecular weight of 254.74 g/mol. Its IUPAC name is 2-(chloromethyl)-6-thiophen-2-yl-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine.
| Compound Name | 2-(chloromethyl)-6-thiophen-2-yl-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine |
|---|---|
| PubChem CID | 121204837 |
| Molecular Formula | C11H11ClN2OS |
| Molecular Weight | 254.74 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-(chloromethyl)-6-thiophen-2-yl-6,8-dihydro-5H-imidazo[2,1-c][1,4]oxazine |
| SMILES | ClCc1cn2c(n1)COC(c1cccs1)C2 |
| InChI | InChI=1S/C11H11ClN2OS/c12-4-8-5-14-6-9(10-2-1-3-16-10)15-7-11(14)13-8/h1-3,5,9H,4,6-7H2 |
| InChIKey | SGYULXKVHCBVTN-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.74 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|