C7H6N2O3S — CID 134897386
3-nitroso-5-thiophen-2-yl-1,3-oxazolidin-2-one (PubChem CID 134897386) has the molecular formula C7H6N2O3S and a molecular weight of 198.20 g/mol. Its IUPAC name is 3-nitroso-5-thiophen-2-yl-1,3-oxazolidin-2-one.
| Compound Name | 3-nitroso-5-thiophen-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 134897386 |
| Molecular Formula | C7H6N2O3S |
| Molecular Weight | 198.20 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 3-nitroso-5-thiophen-2-yl-1,3-oxazolidin-2-one |
| SMILES | O=NN1CC(c2cccs2)OC1=O |
| InChI | InChI=1S/C7H6N2O3S/c10-7-9(8-11)4-5(12-7)6-2-1-3-13-6/h1-3,5H,4H2 |
| InChIKey | PMXQHMMEAWLZGE-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|