C8H7N3O2S — CID 102451785
(3S,5S)-3-azido-5-thiophen-2-yloxolan-2-one (PubChem CID 102451785) has the molecular formula C8H7N3O2S and a molecular weight of 209.23 g/mol. Its IUPAC name is (3S,5S)-3-azido-5-thiophen-2-yloxolan-2-one.
| Compound Name | (3S,5S)-3-azido-5-thiophen-2-yloxolan-2-one |
|---|---|
| PubChem CID | 102451785 |
| Molecular Formula | C8H7N3O2S |
| Molecular Weight | 209.23 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | (3S,5S)-3-azido-5-thiophen-2-yloxolan-2-one |
| SMILES | [N-]=[N+]=N[C@H]1C[C@@H](c2cccs2)OC1=O |
| InChI | InChI=1S/C8H7N3O2S/c9-11-10-5-4-6(13-8(5)12)7-2-1-3-14-7/h1-3,5-6H,4H2/t5-,6-/m0/s1 |
| InChIKey | WQOFNSIFBKJNKE-WDSKDSINSA-N |
| XLogP | 2.41 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|