About 3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one
3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one (PubChem CID 52937999) has the molecular formula C20H15N3O6S
and a molecular weight of 425.42 g/mol. Its IUPAC name is 3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one.
Molecular Properties
| Compound Name | 3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one |
| PubChem CID | 52937999 |
| Molecular Formula | C20H15N3O6S |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one |
| SMILES | O=C1OC(c2ccc([N+](=O)[O-])cc2)CC(c2cccs2)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H15N3O6S/c24-20-21(14-7-9-16(10-8-14)23(27)28)17(19-2-1-11-30-19)12-18(29-20)13-3-5-15(6-4-13)22(25)26/h1-11,17-18H,12H2 |
| InChIKey | RDHPQNYKOJSOLY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one?
The IUPAC name of 3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one (CID 52937999) is 3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one.
What is the SMILES notation for 3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one?
The canonical SMILES for 3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one is O=C1OC(c2ccc([N+](=O)[O-])cc2)CC(c2cccs2)N1c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one?
The InChIKey is RDHPQNYKOJSOLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15N3O6S/c24-20-21(14-7-9-16(10-8-14)23(27)28)17(19-2-1-11-30-19)12-18(29-20)13-3-5-15(6-4-13)22(25)26/h1-11,17-18H,12H2.
What are the key properties of 3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one?
3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one has a molecular weight of 425.42 g/mol, XLogP of 5.39, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one is sourced from PubChem (CID 52937999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).