C20H15N3O6S — CID 52937999
3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one (PubChem CID 52937999) has the molecular formula C20H15N3O6S and a molecular weight of 425.42 g/mol. Its IUPAC name is 3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one.
| Compound Name | 3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 52937999 |
| Molecular Formula | C20H15N3O6S |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 3,6-bis(4-nitrophenyl)-4-thiophen-2-yl-1,3-oxazinan-2-one |
| SMILES | O=C1OC(c2ccc([N+](=O)[O-])cc2)CC(c2cccs2)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H15N3O6S/c24-20-21(14-7-9-16(10-8-14)23(27)28)17(19-2-1-11-30-19)12-18(29-20)13-3-5-15(6-4-13)22(25)26/h1-11,17-18H,12H2 |
| InChIKey | RDHPQNYKOJSOLY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 115.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|