C14H10N2O5 — CID 139218927
4-(2-hydroxyphenyl)-3-(4-nitrophenyl)-1,3-oxazetidin-2-one (PubChem CID 139218927) has the molecular formula C14H10N2O5 and a molecular weight of 286.24 g/mol. Its IUPAC name is 4-(2-hydroxyphenyl)-3-(4-nitrophenyl)-1,3-oxazetidin-2-one.
| Compound Name | 4-(2-hydroxyphenyl)-3-(4-nitrophenyl)-1,3-oxazetidin-2-one |
|---|---|
| PubChem CID | 139218927 |
| Molecular Formula | C14H10N2O5 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 4-(2-hydroxyphenyl)-3-(4-nitrophenyl)-1,3-oxazetidin-2-one |
| SMILES | O=C1OC(c2ccccc2O)N1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H10N2O5/c17-12-4-2-1-3-11(12)13-15(14(18)21-13)9-5-7-10(8-6-9)16(19)20/h1-8,13,17H |
| InChIKey | PWBUOAGDKCJKPC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|