C21H14Cl2N4O4 — CID 135463542
(3S,4R)-3-chloro-1-(4-chlorophenyl)-4-[2-hydroxy-5-[(4-nitrophenyl)diazenyl]phenyl]azetidin-2-one (PubChem CID 135463542) has the molecular formula C21H14Cl2N4O4 and a molecular weight of 457.27 g/mol. Its IUPAC name is (3S,4R)-3-chloro-1-(4-chlorophenyl)-4-[2-hydroxy-5-[(4-nitrophenyl)diazenyl]phenyl]azetidin-2-one.
| Compound Name | (3S,4R)-3-chloro-1-(4-chlorophenyl)-4-[2-hydroxy-5-[(4-nitrophenyl)diazenyl]phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 135463542 |
| Molecular Formula | C21H14Cl2N4O4 |
| Molecular Weight | 457.27 g/mol |
| Exact Mass | 456.04 |
| IUPAC Name | (3S,4R)-3-chloro-1-(4-chlorophenyl)-4-[2-hydroxy-5-[(4-nitrophenyl)diazenyl]phenyl]azetidin-2-one |
| SMILES | O=C1[C@@H](Cl)[C@@H](c2cc(/N=N/c3ccc([N+](=O)[O-])cc3)ccc2O)N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H14Cl2N4O4/c22-12-1-6-15(7-2-12)26-20(19(23)21(26)29)17-11-14(5-10-18(17)28)25-24-13-3-8-16(9-4-13)27(30)31/h1-11,19-20,28H/b25-24+/t19-,20+/m0/s1 |
| InChIKey | MRATWVRXFDCVEG-QQIVJABXSA-N |
| XLogP | 6.06 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.27 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|