C15H24BF3O2 — CID 171110001
2-[4-(2,2-difluorocyclopropyl)-1-fluoro-3,3-dimethylbut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171110001) has the molecular formula C15H24BF3O2 and a molecular weight of 304.16 g/mol. Its IUPAC name is 2-[4-(2,2-difluorocyclopropyl)-1-fluoro-3,3-dimethylbut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[4-(2,2-difluorocyclopropyl)-1-fluoro-3,3-dimethylbut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171110001 |
| Molecular Formula | C15H24BF3O2 |
| Molecular Weight | 304.16 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-[4-(2,2-difluorocyclopropyl)-1-fluoro-3,3-dimethylbut-1-enyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)(C=C(F)B1OC(C)(C)C(C)(C)O1)CC1CC1(F)F |
| InChI | InChI=1S/C15H24BF3O2/c1-12(2,7-10-8-15(10,18)19)9-11(17)16-20-13(3,4)14(5,6)21-16/h9-10H,7-8H2,1-6H3 |
| InChIKey | ZELNPUIJZNSXAK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.16 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|