C14H20BF5O2 — CID 171110049
2-[2-[1-(2,2-difluoroethyl)-3,3-difluorocyclobutyl]-1-fluoroethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171110049) has the molecular formula C14H20BF5O2 and a molecular weight of 326.11 g/mol. Its IUPAC name is 2-[2-[1-(2,2-difluoroethyl)-3,3-difluorocyclobutyl]-1-fluoroethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2-[1-(2,2-difluoroethyl)-3,3-difluorocyclobutyl]-1-fluoroethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171110049 |
| Molecular Formula | C14H20BF5O2 |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 2-[2-[1-(2,2-difluoroethyl)-3,3-difluorocyclobutyl]-1-fluoroethenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(F)=CC2(CC(F)F)CC(F)(F)C2)OC1(C)C |
| InChI | InChI=1S/C14H20BF5O2/c1-11(2)12(3,4)22-15(21-11)9(16)5-13(6-10(17)18)7-14(19,20)8-13/h5,10H,6-8H2,1-4H3 |
| InChIKey | NEYJRFJFEZXCFW-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|