C13H18BF7O2 — CID 171110004
4,4,5,5-tetramethyl-2-[1,5,5,5-tetrafluoro-3-(2,2,2-trifluoroethyl)pent-1-enyl]-1,3,2-dioxaborolane (PubChem CID 171110004) has the molecular formula C13H18BF7O2 and a molecular weight of 350.08 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[1,5,5,5-tetrafluoro-3-(2,2,2-trifluoroethyl)pent-1-enyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[1,5,5,5-tetrafluoro-3-(2,2,2-trifluoroethyl)pent-1-enyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171110004 |
| Molecular Formula | C13H18BF7O2 |
| Molecular Weight | 350.08 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[1,5,5,5-tetrafluoro-3-(2,2,2-trifluoroethyl)pent-1-enyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C(F)=CC(CC(F)(F)F)CC(F)(F)F)OC1(C)C |
| InChI | InChI=1S/C13H18BF7O2/c1-10(2)11(3,4)23-14(22-10)9(15)5-8(6-12(16,17)18)7-13(19,20)21/h5,8H,6-7H2,1-4H3 |
| InChIKey | UQJSXGQSPIAZKJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.08 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|