C13H21BF4O2 — CID 171109988
2-(3-ethyl-1,5,5,5-tetrafluoropent-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171109988) has the molecular formula C13H21BF4O2 and a molecular weight of 296.11 g/mol. Its IUPAC name is 2-(3-ethyl-1,5,5,5-tetrafluoropent-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(3-ethyl-1,5,5,5-tetrafluoropent-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171109988 |
| Molecular Formula | C13H21BF4O2 |
| Molecular Weight | 296.11 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 2-(3-ethyl-1,5,5,5-tetrafluoropent-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CCC(C=C(F)B1OC(C)(C)C(C)(C)O1)CC(F)(F)F |
| InChI | InChI=1S/C13H21BF4O2/c1-6-9(8-13(16,17)18)7-10(15)14-19-11(2,3)12(4,5)20-14/h7,9H,6,8H2,1-5H3 |
| InChIKey | LOSGETFHCLYMJY-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.11 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|