C14H23BF4O2 — CID 171110003
4,4,5,5-tetramethyl-2-(1,6,6,6-tetrafluoro-3,3-dimethylhex-1-enyl)-1,3,2-dioxaborolane (PubChem CID 171110003) has the molecular formula C14H23BF4O2 and a molecular weight of 310.14 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(1,6,6,6-tetrafluoro-3,3-dimethylhex-1-enyl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(1,6,6,6-tetrafluoro-3,3-dimethylhex-1-enyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171110003 |
| Molecular Formula | C14H23BF4O2 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(1,6,6,6-tetrafluoro-3,3-dimethylhex-1-enyl)-1,3,2-dioxaborolane |
| SMILES | CC(C)(C=C(F)B1OC(C)(C)C(C)(C)O1)CCC(F)(F)F |
| InChI | InChI=1S/C14H23BF4O2/c1-11(2,7-8-14(17,18)19)9-10(16)15-20-12(3,4)13(5,6)21-15/h9H,7-8H2,1-6H3 |
| InChIKey | HDJCZYUWYSJUBI-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|