C13H23BF2O2 — CID 171110181
2-(1,5-difluoro-5-methylhex-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 171110181) has the molecular formula C13H23BF2O2 and a molecular weight of 260.13 g/mol. Its IUPAC name is 2-(1,5-difluoro-5-methylhex-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1,5-difluoro-5-methylhex-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171110181 |
| Molecular Formula | C13H23BF2O2 |
| Molecular Weight | 260.13 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 2-(1,5-difluoro-5-methylhex-1-enyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC(C)(F)CCC=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H23BF2O2/c1-11(2,16)9-7-8-10(15)14-17-12(3,4)13(5,6)18-14/h8H,7,9H2,1-6H3 |
| InChIKey | UPXGNAQUKJDFFQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.13 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|