C17H17BClFO4 — CID 171110287
6-chloro-3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]chromen-4-one (PubChem CID 171110287) has the molecular formula C17H17BClFO4 and a molecular weight of 350.58 g/mol. Its IUPAC name is 6-chloro-3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]chromen-4-one.
| Compound Name | 6-chloro-3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]chromen-4-one |
|---|---|
| PubChem CID | 171110287 |
| Molecular Formula | C17H17BClFO4 |
| Molecular Weight | 350.58 g/mol |
| Exact Mass | 350.09 |
| IUPAC Name | 6-chloro-3-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]chromen-4-one |
| SMILES | CC1(C)OB(C(F)=Cc2coc3ccc(Cl)cc3c2=O)OC1(C)C |
| InChI | InChI=1S/C17H17BClFO4/c1-16(2)17(3,4)24-18(23-16)14(20)7-10-9-22-13-6-5-11(19)8-12(13)15(10)21/h5-9H,1-4H3 |
| InChIKey | SNFYZGFIHMIIQT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.58 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|