C12H20BF3O2 — CID 171110563
4,4,5,5-tetramethyl-2-(1,4,4-trifluoro-3,3-dimethylbut-1-enyl)-1,3,2-dioxaborolane (PubChem CID 171110563) has the molecular formula C12H20BF3O2 and a molecular weight of 264.10 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(1,4,4-trifluoro-3,3-dimethylbut-1-enyl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(1,4,4-trifluoro-3,3-dimethylbut-1-enyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 171110563 |
| Molecular Formula | C12H20BF3O2 |
| Molecular Weight | 264.10 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(1,4,4-trifluoro-3,3-dimethylbut-1-enyl)-1,3,2-dioxaborolane |
| SMILES | CC(C)(C=C(F)B1OC(C)(C)C(C)(C)O1)C(F)F |
| InChI | InChI=1S/C12H20BF3O2/c1-10(2,9(15)16)7-8(14)13-17-11(3,4)12(5,6)18-13/h7,9H,1-6H3 |
| InChIKey | VUPQICYTQDJVEE-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.10 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|