C18H19BF2O4 — CID 171111122
methyl 3-[4-fluoro-2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]prop-2-ynoate (PubChem CID 171111122) has the molecular formula C18H19BF2O4 and a molecular weight of 348.15 g/mol. Its IUPAC name is methyl 3-[4-fluoro-2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]prop-2-ynoate.
| Compound Name | methyl 3-[4-fluoro-2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]prop-2-ynoate |
|---|---|
| PubChem CID | 171111122 |
| Molecular Formula | C18H19BF2O4 |
| Molecular Weight | 348.15 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | methyl 3-[4-fluoro-2-[2-fluoro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)ethenyl]phenyl]prop-2-ynoate |
| SMILES | COC(=O)C#Cc1ccc(F)cc1C=C(F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H19BF2O4/c1-17(2)18(3,4)25-19(24-17)15(21)11-13-10-14(20)8-6-12(13)7-9-16(22)23-5/h6,8,10-11H,1-5H3 |
| InChIKey | DOYAFLOFTCLLQL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.15 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|