C16H19NO2 — CID 171118071
(2S)-2-(methylamino)-1,1-diphenylpropane-1,3-diol (PubChem CID 171118071) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is (2S)-2-(methylamino)-1,1-diphenylpropane-1,3-diol.
| Compound Name | (2S)-2-(methylamino)-1,1-diphenylpropane-1,3-diol |
|---|---|
| PubChem CID | 171118071 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | (2S)-2-(methylamino)-1,1-diphenylpropane-1,3-diol |
| SMILES | CN[C@@H](CO)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H19NO2/c1-17-15(12-18)16(19,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-11,15,17-19H,12H2,1H3/t15-/m0/s1 |
| InChIKey | KCBHFBNDKBEBRM-HNNXBMFYSA-N |
| XLogP | 1.50 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |