C15H14O4 — CID 171118722
[(Z,6Z)-6-(5-oxofuran-2-ylidene)hex-2-en-4-ynyl] (E)-2-methylbut-2-enoate (PubChem CID 171118722) has the molecular formula C15H14O4 and a molecular weight of 258.27 g/mol. Its IUPAC name is [(Z,6Z)-6-(5-oxofuran-2-ylidene)hex-2-en-4-ynyl] (E)-2-methylbut-2-enoate.
| Compound Name | [(Z,6Z)-6-(5-oxofuran-2-ylidene)hex-2-en-4-ynyl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 171118722 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | [(Z,6Z)-6-(5-oxofuran-2-ylidene)hex-2-en-4-ynyl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OC/C=C\C#C/C=C1/C=CC(=O)O1 |
| InChI | InChI=1S/C15H14O4/c1-3-12(2)15(17)18-11-7-5-4-6-8-13-9-10-14(16)19-13/h3,5,7-10H,11H2,1-2H3/b7-5-,12-3+,13-8- |
| InChIKey | PMCQFFPVAIBCII-SOBNSUNWSA-N |
| XLogP | 2.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|