C17H32N3+ — CID 171120685
(1S,4S,8R,9S,10R,12R)-9-hexyl-10-methyl-5-aza-7-azoniatricyclo[6.3.1.04,12]dodec-6-en-6-amine (PubChem CID 171120685) has the molecular formula C17H32N3+ and a molecular weight of 278.46 g/mol. Its IUPAC name is (1S,4S,8R,9S,10R,12R)-9-hexyl-10-methyl-5-aza-7-azoniatricyclo[6.3.1.04,12]dodec-6-en-6-amine.
| Compound Name | (1S,4S,8R,9S,10R,12R)-9-hexyl-10-methyl-5-aza-7-azoniatricyclo[6.3.1.04,12]dodec-6-en-6-amine |
|---|---|
| PubChem CID | 171120685 |
| Molecular Formula | C17H32N3+ |
| Molecular Weight | 278.46 g/mol |
| Exact Mass | 278.26 |
| IUPAC Name | (1S,4S,8R,9S,10R,12R)-9-hexyl-10-methyl-5-aza-7-azoniatricyclo[6.3.1.04,12]dodec-6-en-6-amine |
| SMILES | CCCCCC[C@@H]1[C@H]2[NH+]=C(N)N[C@H]3CC[C@@H](C[C@H]1C)[C@@H]23 |
| InChI | InChI=1S/C17H31N3/c1-3-4-5-6-7-13-11(2)10-12-8-9-14-15(12)16(13)20-17(18)19-14/h11-16H,3-10H2,1-2H3,(H3,18,19,20)/p+1/t11-,12+,13+,14+,15-,16-/m1/s1 |
| InChIKey | WLAJCPMJVVKJFQ-FOLNQXHWSA-O |
| XLogP | 1.37 |
| TPSA | 52.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.46 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|