C17H32S — CID 135265546
3,6-dimethyl-2-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-thiol (PubChem CID 135265546) has the molecular formula C17H32S and a molecular weight of 268.51 g/mol. Its IUPAC name is 3,6-dimethyl-2-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-thiol.
| Compound Name | 3,6-dimethyl-2-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-thiol |
|---|---|
| PubChem CID | 135265546 |
| Molecular Formula | C17H32S |
| Molecular Weight | 268.51 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | 3,6-dimethyl-2-pentyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene-1-thiol |
| SMILES | CCCCCC1C(C)CC2CC(C)CCC2C1S |
| InChI | InChI=1S/C17H32S/c1-4-5-6-7-15-13(3)11-14-10-12(2)8-9-16(14)17(15)18/h12-18H,4-11H2,1-3H3 |
| InChIKey | PORXHFQBRFNBRO-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.51 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|