C21H36O4 — CID 171120964
[(2S,5E,16E)-2-hydroxy-4-oxononadeca-5,16-dienyl] acetate (PubChem CID 171120964) has the molecular formula C21H36O4 and a molecular weight of 352.52 g/mol. Its IUPAC name is [(2S,5E,16E)-2-hydroxy-4-oxononadeca-5,16-dienyl] acetate.
| Compound Name | [(2S,5E,16E)-2-hydroxy-4-oxononadeca-5,16-dienyl] acetate |
|---|---|
| PubChem CID | 171120964 |
| Molecular Formula | C21H36O4 |
| Molecular Weight | 352.52 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | [(2S,5E,16E)-2-hydroxy-4-oxononadeca-5,16-dienyl] acetate |
| SMILES | CC/C=C/CCCCCCCCC/C=C/C(=O)C[C@H](O)COC(C)=O |
| InChI | InChI=1S/C21H36O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-20(23)17-21(24)18-25-19(2)22/h4-5,15-16,21,24H,3,6-14,17-18H2,1-2H3/b5-4+,16-15+/t21-/m0/s1 |
| InChIKey | MYFQKXPELFRJRW-ABOKRIGSSA-N |
| XLogP | 4.90 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|