C14H16O4 — CID 171120982
3-[(E)-but-2-enyl]-5-hydroxy-5,7-dimethyl-4H-1-benzofuran-2,6-dione (PubChem CID 171120982) has the molecular formula C14H16O4 and a molecular weight of 248.28 g/mol. Its IUPAC name is 3-[(E)-but-2-enyl]-5-hydroxy-5,7-dimethyl-4H-1-benzofuran-2,6-dione.
| Compound Name | 3-[(E)-but-2-enyl]-5-hydroxy-5,7-dimethyl-4H-1-benzofuran-2,6-dione |
|---|---|
| PubChem CID | 171120982 |
| Molecular Formula | C14H16O4 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 3-[(E)-but-2-enyl]-5-hydroxy-5,7-dimethyl-4H-1-benzofuran-2,6-dione |
| SMILES | C/C=C/CC1=C2CC(C)(O)C(=O)C(C)=C2OC1=O |
| InChI | InChI=1S/C14H16O4/c1-4-5-6-9-10-7-14(3,17)12(15)8(2)11(10)18-13(9)16/h4-5,17H,6-7H2,1-3H3/b5-4+ |
| InChIKey | AEUJSHIYFLRGQB-SNAWJCMRSA-N |
| XLogP | 1.80 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|