C29H38O8 — CID 5368913
(1Z)-8-[(E)-hex-4-enoyl]-5a,6,9-trihydroxy-1-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-2-methoxy-3,4a,6,9a-tetramethyl-7,9b-dihydrodibenzofuran-4-one (PubChem CID 5368913) has the molecular formula C29H38O8 and a molecular weight of 514.62 g/mol. Its IUPAC name is (1Z)-8-[(E)-hex-4-enoyl]-5a,6,9-trihydroxy-1-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-2-methoxy-3,4a,6,9a-tetramethyl-7,9b-dihydrodibenzofuran-4-one.
| Compound Name | (1Z)-8-[(E)-hex-4-enoyl]-5a,6,9-trihydroxy-1-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-2-methoxy-3,4a,6,9a-tetramethyl-7,9b-dihydrodibenzofuran-4-one |
|---|---|
| PubChem CID | 5368913 |
| Molecular Formula | C29H38O8 |
| Molecular Weight | 514.62 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | (1Z)-8-[(E)-hex-4-enoyl]-5a,6,9-trihydroxy-1-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-2-methoxy-3,4a,6,9a-tetramethyl-7,9b-dihydrodibenzofuran-4-one |
| SMILES | C/C=C/C=C/C(O)=C1/C(OC)=C(C)C(=O)C2(C)OC3(O)C(C)(O)CC(C(=O)CC/C=C/C)=C(O)C3(C)C12 |
| InChI | InChI=1S/C29H38O8/c1-8-10-12-14-19(30)18-16-26(4,34)29(35)27(5,25(18)33)23-21(20(31)15-13-11-9-2)22(36-7)17(3)24(32)28(23,6)37-29/h8-11,13,15,23,31,33-35H,12,14,16H2,1-7H3/b10-8+,11-9+,15-13+,21-20+ |
| InChIKey | KGJOFKCTTRSMNE-OORXHBCQSA-N |
| XLogP | 4.43 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.62 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|