C28H32O8 — CID 44584013
(4S,4aR,5aS,9Z,9aR,9bS)-2-[(2E,4E)-hexa-2,4-dienoyl]-4,4a,8-trihydroxy-9-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-4,5a,7,9b-tetramethyl-9aH-dibenzofuran-3,6-dione (PubChem CID 44584013) has the molecular formula C28H32O8 and a molecular weight of 496.56 g/mol. Its IUPAC name is (4S,4aR,5aS,9Z,9aR,9bS)-2-[(2E,4E)-hexa-2,4-dienoyl]-4,4a,8-trihydroxy-9-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-4,5a,7,9b-tetramethyl-9aH-dibenzofuran-3,6-dione.
| Compound Name | (4S,4aR,5aS,9Z,9aR,9bS)-2-[(2E,4E)-hexa-2,4-dienoyl]-4,4a,8-trihydroxy-9-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-4,5a,7,9b-tetramethyl-9aH-dibenzofuran-3,6-dione |
|---|---|
| PubChem CID | 44584013 |
| Molecular Formula | C28H32O8 |
| Molecular Weight | 496.56 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | (4S,4aR,5aS,9Z,9aR,9bS)-2-[(2E,4E)-hexa-2,4-dienoyl]-4,4a,8-trihydroxy-9-[(2E,4E)-1-hydroxyhexa-2,4-dienylidene]-4,5a,7,9b-tetramethyl-9aH-dibenzofuran-3,6-dione |
| SMILES | C/C=C/C=C/C(=O)C1=C[C@@]2(C)[C@H]3/C(=C(O)\C=C\C=C\C)C(O)=C(C)C(=O)[C@@]3(C)O[C@@]2(O)[C@@](C)(O)C1=O |
| InChI | InChI=1S/C28H32O8/c1-7-9-11-13-18(29)17-15-25(4)22-20(19(30)14-12-10-8-2)21(31)16(3)23(32)26(22,5)36-28(25,35)27(6,34)24(17)33/h7-15,22,30-31,34-35H,1-6H3/b9-7+,10-8+,13-11+,14-12+,20-19+/t22-,25+,26+,27+,28-/m1/s1 |
| InChIKey | NCHYGSCJZYVXGX-QQRNOQAZSA-N |
| XLogP | 3.41 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.56 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|