C18H34O5 — CID 171121107
[(2R,3R)-3-hydroxy-1-methoxy-4-methyl-1-oxopentan-2-yl] undecanoate (PubChem CID 171121107) has the molecular formula C18H34O5 and a molecular weight of 330.47 g/mol. Its IUPAC name is [(2R,3R)-3-hydroxy-1-methoxy-4-methyl-1-oxopentan-2-yl] undecanoate.
| Compound Name | [(2R,3R)-3-hydroxy-1-methoxy-4-methyl-1-oxopentan-2-yl] undecanoate |
|---|---|
| PubChem CID | 171121107 |
| Molecular Formula | C18H34O5 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | [(2R,3R)-3-hydroxy-1-methoxy-4-methyl-1-oxopentan-2-yl] undecanoate |
| SMILES | CCCCCCCCCCC(=O)O[C@@H](C(=O)OC)[C@H](O)C(C)C |
| InChI | InChI=1S/C18H34O5/c1-5-6-7-8-9-10-11-12-13-15(19)23-17(18(21)22-4)16(20)14(2)3/h14,16-17,20H,5-13H2,1-4H3/t16-,17-/m1/s1 |
| InChIKey | WJMXFHHTKZEBBE-IAGOWNOFSA-N |
| XLogP | 3.62 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|