C26H42N2O5S — CID 171127020
(2R)-2-[(4S,5S)-8-cyclopentyl-4-methyl-5-[[methyl(oxan-4-ylmethyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol (PubChem CID 171127020) has the molecular formula C26H42N2O5S and a molecular weight of 494.70 g/mol. Its IUPAC name is (2R)-2-[(4S,5S)-8-cyclopentyl-4-methyl-5-[[methyl(oxan-4-ylmethyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol.
| Compound Name | (2R)-2-[(4S,5S)-8-cyclopentyl-4-methyl-5-[[methyl(oxan-4-ylmethyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
|---|---|
| PubChem CID | 171127020 |
| Molecular Formula | C26H42N2O5S |
| Molecular Weight | 494.70 g/mol |
| Exact Mass | 494.28 |
| IUPAC Name | (2R)-2-[(4S,5S)-8-cyclopentyl-4-methyl-5-[[methyl(oxan-4-ylmethyl)amino]methyl]-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-2-yl]propan-1-ol |
| SMILES | C[C@H](CO)N1C[C@H](C)[C@@H](CN(C)CC2CCOCC2)Oc2cc(C3CCCC3)ccc2S1(=O)=O |
| InChI | InChI=1S/C26H42N2O5S/c1-19-15-28(20(2)18-29)34(30,31)26-9-8-23(22-6-4-5-7-22)14-24(26)33-25(19)17-27(3)16-21-10-12-32-13-11-21/h8-9,14,19-22,25,29H,4-7,10-13,15-18H2,1-3H3/t19-,20+,25+/m0/s1 |
| InChIKey | IMYJIJPLIWLGRV-WZOHSFFVSA-N |
| XLogP | 3.47 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.70 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |