C26H40N2O5S — CID 54628672
4-[(4R,5R)-5-[[cyclopentylmethyl(methyl)amino]methyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-8-yl]-2-methylbut-3-yn-2-ol (PubChem CID 54628672) has the molecular formula C26H40N2O5S and a molecular weight of 492.68 g/mol. Its IUPAC name is 4-[(4R,5R)-5-[[cyclopentylmethyl(methyl)amino]methyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-8-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[(4R,5R)-5-[[cyclopentylmethyl(methyl)amino]methyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-8-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 54628672 |
| Molecular Formula | C26H40N2O5S |
| Molecular Weight | 492.68 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 4-[(4R,5R)-5-[[cyclopentylmethyl(methyl)amino]methyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-8-yl]-2-methylbut-3-yn-2-ol |
| SMILES | C[C@@H]1CN([C@H](C)CO)S(=O)(=O)c2ccc(C#CC(C)(C)O)cc2O[C@H]1CN(C)CC1CCCC1 |
| InChI | InChI=1S/C26H40N2O5S/c1-19-15-28(20(2)18-29)34(31,32)25-11-10-21(12-13-26(3,4)30)14-23(25)33-24(19)17-27(5)16-22-8-6-7-9-22/h10-11,14,19-20,22,24,29-30H,6-9,15-18H2,1-5H3/t19-,20-,24+/m1/s1 |
| InChIKey | ABVNQTLZZFSGPC-REHUZNOOSA-N |
| XLogP | 2.70 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.68 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|