C21H32N2O5S — CID 54623002
4-[(4S,5S)-5-[(dimethylamino)methyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-8-yl]-2-methylbut-3-yn-2-ol (PubChem CID 54623002) has the molecular formula C21H32N2O5S and a molecular weight of 424.56 g/mol. Its IUPAC name is 4-[(4S,5S)-5-[(dimethylamino)methyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-8-yl]-2-methylbut-3-yn-2-ol.
| Compound Name | 4-[(4S,5S)-5-[(dimethylamino)methyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-8-yl]-2-methylbut-3-yn-2-ol |
|---|---|
| PubChem CID | 54623002 |
| Molecular Formula | C21H32N2O5S |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | 4-[(4S,5S)-5-[(dimethylamino)methyl]-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-8-yl]-2-methylbut-3-yn-2-ol |
| SMILES | C[C@H](CO)N1C[C@H](C)[C@@H](CN(C)C)Oc2cc(C#CC(C)(C)O)ccc2S1(=O)=O |
| InChI | InChI=1S/C21H32N2O5S/c1-15-12-23(16(2)14-24)29(26,27)20-8-7-17(9-10-21(3,4)25)11-18(20)28-19(15)13-22(5)6/h7-8,11,15-16,19,24-25H,12-14H2,1-6H3/t15-,16+,19+/m0/s1 |
| InChIKey | ZWVQEPOLYSDTGJ-FRQCXROJSA-N |
| XLogP | 1.14 |
| TPSA | 90.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|