C24H37N3O6S — CID 54623204
2-(dimethylamino)-N-[[(4R,5R)-8-(3-hydroxy-3-methylbut-1-ynyl)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylacetamide (PubChem CID 54623204) has the molecular formula C24H37N3O6S and a molecular weight of 495.64 g/mol. Its IUPAC name is 2-(dimethylamino)-N-[[(4R,5R)-8-(3-hydroxy-3-methylbut-1-ynyl)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylacetamide.
| Compound Name | 2-(dimethylamino)-N-[[(4R,5R)-8-(3-hydroxy-3-methylbut-1-ynyl)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 54623204 |
| Molecular Formula | C24H37N3O6S |
| Molecular Weight | 495.64 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 2-(dimethylamino)-N-[[(4R,5R)-8-(3-hydroxy-3-methylbut-1-ynyl)-2-[(2S)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylacetamide |
| SMILES | C[C@@H]1CN([C@@H](C)CO)S(=O)(=O)c2ccc(C#CC(C)(C)O)cc2O[C@H]1CN(C)C(=O)CN(C)C |
| InChI | InChI=1S/C24H37N3O6S/c1-17-13-27(18(2)16-28)34(31,32)22-9-8-19(10-11-24(3,4)30)12-20(22)33-21(17)14-26(7)23(29)15-25(5)6/h8-9,12,17-18,21,28,30H,13-16H2,1-7H3/t17-,18+,21+/m1/s1 |
| InChIKey | QRXMTQJSRFMEAJ-LQWHRVPQSA-N |
| XLogP | 0.60 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.64 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|