C27H40N2O6S — CID 54629138
N-[[(4S,5S)-8-(3-hydroxy-3-methylbut-1-ynyl)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylcyclohexanecarboxamide (PubChem CID 54629138) has the molecular formula C27H40N2O6S and a molecular weight of 520.69 g/mol. Its IUPAC name is N-[[(4S,5S)-8-(3-hydroxy-3-methylbut-1-ynyl)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylcyclohexanecarboxamide.
| Compound Name | N-[[(4S,5S)-8-(3-hydroxy-3-methylbut-1-ynyl)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylcyclohexanecarboxamide |
|---|---|
| PubChem CID | 54629138 |
| Molecular Formula | C27H40N2O6S |
| Molecular Weight | 520.69 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | N-[[(4S,5S)-8-(3-hydroxy-3-methylbut-1-ynyl)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylcyclohexanecarboxamide |
| SMILES | C[C@H](CO)N1C[C@H](C)[C@@H](CN(C)C(=O)C2CCCCC2)Oc2cc(C#CC(C)(C)O)ccc2S1(=O)=O |
| InChI | InChI=1S/C27H40N2O6S/c1-19-16-29(20(2)18-30)36(33,34)25-12-11-21(13-14-27(3,4)32)15-23(25)35-24(19)17-28(5)26(31)22-9-7-6-8-10-22/h11-12,15,19-20,22,24,30,32H,6-10,16-18H2,1-5H3/t19-,20+,24+/m0/s1 |
| InChIKey | DFZSRASGPYXCOB-DCLXLUIPSA-N |
| XLogP | 2.62 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.69 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|