C25H36N2O6S — CID 54621952
2-cyclopropyl-N-[[(4R,5R)-8-(3-hydroxy-3-methylbut-1-ynyl)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylacetamide (PubChem CID 54621952) has the molecular formula C25H36N2O6S and a molecular weight of 492.64 g/mol. Its IUPAC name is 2-cyclopropyl-N-[[(4R,5R)-8-(3-hydroxy-3-methylbut-1-ynyl)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylacetamide.
| Compound Name | 2-cyclopropyl-N-[[(4R,5R)-8-(3-hydroxy-3-methylbut-1-ynyl)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylacetamide |
|---|---|
| PubChem CID | 54621952 |
| Molecular Formula | C25H36N2O6S |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.23 |
| IUPAC Name | 2-cyclopropyl-N-[[(4R,5R)-8-(3-hydroxy-3-methylbut-1-ynyl)-2-[(2R)-1-hydroxypropan-2-yl]-4-methyl-1,1-dioxo-4,5-dihydro-3H-6,1λ6,2-benzoxathiazocin-5-yl]methyl]-N-methylacetamide |
| SMILES | C[C@@H]1CN([C@H](C)CO)S(=O)(=O)c2ccc(C#CC(C)(C)O)cc2O[C@H]1CN(C)C(=O)CC1CC1 |
| InChI | InChI=1S/C25H36N2O6S/c1-17-14-27(18(2)16-28)34(31,32)23-9-8-20(10-11-25(3,4)30)12-21(23)33-22(17)15-26(5)24(29)13-19-6-7-19/h8-9,12,17-19,22,28,30H,6-7,13-16H2,1-5H3/t17-,18-,22+/m1/s1 |
| InChIKey | WPKJJRQANGSZGL-HMFYCAOWSA-N |
| XLogP | 1.84 |
| TPSA | 107.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|