C21H24ClN3O5 — CID 17112771
N-(2-chlorophenyl)-4-[2-[4-(2-ethoxyethoxy)benzoyl]hydrazinyl]-4-oxobutanamide (PubChem CID 17112771) has the molecular formula C21H24ClN3O5 and a molecular weight of 433.89 g/mol. Its IUPAC name is N-(2-chlorophenyl)-4-[2-[4-(2-ethoxyethoxy)benzoyl]hydrazinyl]-4-oxobutanamide.
| Compound Name | N-(2-chlorophenyl)-4-[2-[4-(2-ethoxyethoxy)benzoyl]hydrazinyl]-4-oxobutanamide |
|---|---|
| PubChem CID | 17112771 |
| Molecular Formula | C21H24ClN3O5 |
| Molecular Weight | 433.89 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-(2-chlorophenyl)-4-[2-[4-(2-ethoxyethoxy)benzoyl]hydrazinyl]-4-oxobutanamide |
| SMILES | CCOCCOc1ccc(C(=O)NNC(=O)CCC(=O)Nc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C21H24ClN3O5/c1-2-29-13-14-30-16-9-7-15(8-10-16)21(28)25-24-20(27)12-11-19(26)23-18-6-4-3-5-17(18)22/h3-10H,2,11-14H2,1H3,(H,23,26)(H,24,27)(H,25,28) |
| InChIKey | JIBBBPSSAORXSW-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.89 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|